C17H21ClFNO — CID 102855965
2-[1-[(3-chloro-2-fluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-one (PubChem CID 102855965) has the molecular formula C17H21ClFNO and a molecular weight of 309.81 g/mol. Its IUPAC name is 2-[1-[(3-chloro-2-fluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-one.
| Compound Name | 2-[1-[(3-chloro-2-fluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-one |
|---|---|
| PubChem CID | 102855965 |
| Molecular Formula | C17H21ClFNO |
| Molecular Weight | 309.81 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-[1-[(3-chloro-2-fluorophenyl)methyl]pyrrolidin-2-yl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1C1CCCN1Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C17H21ClFNO/c18-14-7-3-5-12(17(14)19)11-20-10-4-8-15(20)13-6-1-2-9-16(13)21/h3,5,7,13,15H,1-2,4,6,8-11H2 |
| InChIKey | PRVHDUSONMKNHP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.81 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |