C16H19ClFNO — CID 107881215
2-[1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-2-yl]cyclopentan-1-one (PubChem CID 107881215) has the molecular formula C16H19ClFNO and a molecular weight of 295.78 g/mol. Its IUPAC name is 2-[1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-2-yl]cyclopentan-1-one.
| Compound Name | 2-[1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-2-yl]cyclopentan-1-one |
|---|---|
| PubChem CID | 107881215 |
| Molecular Formula | C16H19ClFNO |
| Molecular Weight | 295.78 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[1-[(4-chloro-3-fluorophenyl)methyl]pyrrolidin-2-yl]cyclopentan-1-one |
| SMILES | O=C1CCCC1C1CCCN1Cc1ccc(Cl)c(F)c1 |
| InChI | InChI=1S/C16H19ClFNO/c17-13-7-6-11(9-14(13)18)10-19-8-2-4-15(19)12-3-1-5-16(12)20/h6-7,9,12,15H,1-5,8,10H2 |
| InChIKey | KTSHKFKPBWLJLT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.78 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |