C17H16ClFO2 — CID 102856635
2-[(3-chloro-2-fluorophenyl)methyl]-3-(2-methylphenyl)propanoic acid (PubChem CID 102856635) has the molecular formula C17H16ClFO2 and a molecular weight of 306.76 g/mol. Its IUPAC name is 2-[(3-chloro-2-fluorophenyl)methyl]-3-(2-methylphenyl)propanoic acid.
| Compound Name | 2-[(3-chloro-2-fluorophenyl)methyl]-3-(2-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 102856635 |
| Molecular Formula | C17H16ClFO2 |
| Molecular Weight | 306.76 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 2-[(3-chloro-2-fluorophenyl)methyl]-3-(2-methylphenyl)propanoic acid |
| SMILES | Cc1ccccc1CC(Cc1cccc(Cl)c1F)C(=O)O |
| InChI | InChI=1S/C17H16ClFO2/c1-11-5-2-3-6-12(11)9-14(17(20)21)10-13-7-4-8-15(18)16(13)19/h2-8,14H,9-10H2,1H3,(H,20,21) |
| InChIKey | JIWJIGZAHBTTPG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.76 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |