C12H15ClFNO — CID 102857003
1-amino-3-(3-chloro-2-fluorophenyl)-2-cyclopropylpropan-2-ol (PubChem CID 102857003) has the molecular formula C12H15ClFNO and a molecular weight of 243.71 g/mol. Its IUPAC name is 1-amino-3-(3-chloro-2-fluorophenyl)-2-cyclopropylpropan-2-ol.
| Compound Name | 1-amino-3-(3-chloro-2-fluorophenyl)-2-cyclopropylpropan-2-ol |
|---|---|
| PubChem CID | 102857003 |
| Molecular Formula | C12H15ClFNO |
| Molecular Weight | 243.71 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 1-amino-3-(3-chloro-2-fluorophenyl)-2-cyclopropylpropan-2-ol |
| SMILES | NCC(O)(Cc1cccc(Cl)c1F)C1CC1 |
| InChI | InChI=1S/C12H15ClFNO/c13-10-3-1-2-8(11(10)14)6-12(16,7-15)9-4-5-9/h1-3,9,16H,4-7,15H2 |
| InChIKey | QHLRWFLTFWFKJM-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.71 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |