C14H20ClFO — CID 102857067
4-[(3-chloro-2-fluorophenyl)methyl]heptan-4-ol (PubChem CID 102857067) has the molecular formula C14H20ClFO and a molecular weight of 258.76 g/mol. Its IUPAC name is 4-[(3-chloro-2-fluorophenyl)methyl]heptan-4-ol.
| Compound Name | 4-[(3-chloro-2-fluorophenyl)methyl]heptan-4-ol |
|---|---|
| PubChem CID | 102857067 |
| Molecular Formula | C14H20ClFO |
| Molecular Weight | 258.76 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | 4-[(3-chloro-2-fluorophenyl)methyl]heptan-4-ol |
| SMILES | CCCC(O)(CCC)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C14H20ClFO/c1-3-8-14(17,9-4-2)10-11-6-5-7-12(15)13(11)16/h5-7,17H,3-4,8-10H2,1-2H3 |
| InChIKey | RFIRCCPEAOYNGK-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.76 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |