C17H19ClFNO — CID 67674348
(2R)-2-amino-1-(3-chloro-2-fluorophenyl)-3-methyl-4-phenylbutan-2-ol (PubChem CID 67674348) has the molecular formula C17H19ClFNO and a molecular weight of 307.80 g/mol. Its IUPAC name is (2R)-2-amino-1-(3-chloro-2-fluorophenyl)-3-methyl-4-phenylbutan-2-ol.
| Compound Name | (2R)-2-amino-1-(3-chloro-2-fluorophenyl)-3-methyl-4-phenylbutan-2-ol |
|---|---|
| PubChem CID | 67674348 |
| Molecular Formula | C17H19ClFNO |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | (2R)-2-amino-1-(3-chloro-2-fluorophenyl)-3-methyl-4-phenylbutan-2-ol |
| SMILES | CC(Cc1ccccc1)[C@](N)(O)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C17H19ClFNO/c1-12(10-13-6-3-2-4-7-13)17(20,21)11-14-8-5-9-15(18)16(14)19/h2-9,12,21H,10-11,20H2,1H3/t12?,17-/m1/s1 |
| InChIKey | WTZVRKAJZASSIP-RGUGMKFQSA-N |
| XLogP | 3.55 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|