C13H19ClFNS — CID 102857611
1-(3-chloro-2-fluorophenyl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine (PubChem CID 102857611) has the molecular formula C13H19ClFNS and a molecular weight of 275.82 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine |
|---|---|
| PubChem CID | 102857611 |
| Molecular Formula | C13H19ClFNS |
| Molecular Weight | 275.82 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-N-methyl-3-propan-2-ylsulfanylpropan-2-amine |
| SMILES | CNC(CSC(C)C)Cc1cccc(Cl)c1F |
| InChI | InChI=1S/C13H19ClFNS/c1-9(2)17-8-11(16-3)7-10-5-4-6-12(14)13(10)15/h4-6,9,11,16H,7-8H2,1-3H3 |
| InChIKey | GGGSMWYRVXNJFY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.82 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |