C18H29ClFN — CID 82789169
1-(3-chloro-2-fluorophenyl)-N-methylundecan-2-amine (PubChem CID 82789169) has the molecular formula C18H29ClFN and a molecular weight of 313.89 g/mol. Its IUPAC name is 1-(3-chloro-2-fluorophenyl)-N-methylundecan-2-amine.
| Compound Name | 1-(3-chloro-2-fluorophenyl)-N-methylundecan-2-amine |
|---|---|
| PubChem CID | 82789169 |
| Molecular Formula | C18H29ClFN |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 1-(3-chloro-2-fluorophenyl)-N-methylundecan-2-amine |
| SMILES | CCCCCCCCCC(Cc1cccc(Cl)c1F)NC |
| InChI | InChI=1S/C18H29ClFN/c1-3-4-5-6-7-8-9-12-16(21-2)14-15-11-10-13-17(19)18(15)20/h10-11,13,16,21H,3-9,12,14H2,1-2H3 |
| InChIKey | ULMUPAKIWSOMTR-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|