C15H24N2O3 — CID 102860471
1-(3-aminophenoxy)-3-[cyclobutyl(2-hydroxyethyl)amino]propan-2-ol (PubChem CID 102860471) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(3-aminophenoxy)-3-[cyclobutyl(2-hydroxyethyl)amino]propan-2-ol.
| Compound Name | 1-(3-aminophenoxy)-3-[cyclobutyl(2-hydroxyethyl)amino]propan-2-ol |
|---|---|
| PubChem CID | 102860471 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(3-aminophenoxy)-3-[cyclobutyl(2-hydroxyethyl)amino]propan-2-ol |
| SMILES | Nc1cccc(OCC(O)CN(CCO)C2CCC2)c1 |
| InChI | InChI=1S/C15H24N2O3/c16-12-3-1-6-15(9-12)20-11-14(19)10-17(7-8-18)13-4-2-5-13/h1,3,6,9,13-14,18-19H,2,4-5,7-8,10-11,16H2 |
| InChIKey | RCHQVWSPWKKZIO-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|