C13H20N2O4 — CID 106667883
1-[3-(3-aminophenoxy)-2-hydroxypropyl]pyrrolidine-3,4-diol (PubChem CID 106667883) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 1-[3-(3-aminophenoxy)-2-hydroxypropyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[3-(3-aminophenoxy)-2-hydroxypropyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667883 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 1-[3-(3-aminophenoxy)-2-hydroxypropyl]pyrrolidine-3,4-diol |
| SMILES | Nc1cccc(OCC(O)CN2CC(O)C(O)C2)c1 |
| InChI | InChI=1S/C13H20N2O4/c14-9-2-1-3-11(4-9)19-8-10(16)5-15-6-12(17)13(18)7-15/h1-4,10,12-13,16-18H,5-8,14H2 |
| InChIKey | VQTLUDNHJIPPRF-UHFFFAOYSA-N |
| XLogP | -0.95 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|