C13H20N2O4S — CID 43581117
1-(3-aminophenoxy)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol (PubChem CID 43581117) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 1-(3-aminophenoxy)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol.
| Compound Name | 1-(3-aminophenoxy)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 43581117 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 1-(3-aminophenoxy)-3-(1,1-dioxo-1,4-thiazinan-4-yl)propan-2-ol |
| SMILES | Nc1cccc(OCC(O)CN2CCS(=O)(=O)CC2)c1 |
| InChI | InChI=1S/C13H20N2O4S/c14-11-2-1-3-13(8-11)19-10-12(16)9-15-4-6-20(17,18)7-5-15/h1-3,8,12,16H,4-7,9-10,14H2 |
| InChIKey | BFHDUKUEBRPCAR-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 92.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|