C14H26ClNO — CID 102860508
N-(3-chloropropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine (PubChem CID 102860508) has the molecular formula C14H26ClNO and a molecular weight of 259.82 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine.
| Compound Name | N-(3-chloropropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 102860508 |
| Molecular Formula | C14H26ClNO |
| Molecular Weight | 259.82 g/mol |
| Exact Mass | 259.17 |
| IUPAC Name | N-(3-chloropropyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
| SMILES | CC1(C)CCC(CN(CCCCl)C2CCC2)O1 |
| InChI | InChI=1S/C14H26ClNO/c1-14(2)8-7-13(17-14)11-16(10-4-9-15)12-5-3-6-12/h12-13H,3-11H2,1-2H3 |
| InChIKey | DMWRIBWAAQQFQY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|