C13H24ClNO — CID 102861197
N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine (PubChem CID 102861197) has the molecular formula C13H24ClNO and a molecular weight of 245.79 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine.
| Compound Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
|---|---|
| PubChem CID | 102861197 |
| Molecular Formula | C13H24ClNO |
| Molecular Weight | 245.79 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]cyclobutanamine |
| SMILES | CC1(C)CCC(CN(CCCl)C2CCC2)O1 |
| InChI | InChI=1S/C13H24ClNO/c1-13(2)7-6-12(16-13)10-15(9-8-14)11-4-3-5-11/h11-12H,3-10H2,1-2H3 |
| InChIKey | QJTQHXVLXUJSHT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.79 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|