C11H20ClF2NO — CID 107487840
N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 107487840) has the molecular formula C11H20ClF2NO and a molecular weight of 255.74 g/mol. Its IUPAC name is N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487840 |
| Molecular Formula | C11H20ClF2NO |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-(2-chloroethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | CC1(C)CCC(CN(CCCl)CC(F)F)O1 |
| InChI | InChI=1S/C11H20ClF2NO/c1-11(2)4-3-9(16-11)7-15(6-5-12)8-10(13)14/h9-10H,3-8H2,1-2H3 |
| InChIKey | BRKAMSXKYIDFHW-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|