C13H21ClF3NO — CID 107488807
N-(2-chloroethyl)-2,2,2-trifluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine (PubChem CID 107488807) has the molecular formula C13H21ClF3NO and a molecular weight of 299.76 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2,2-trifluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107488807 |
| Molecular Formula | C13H21ClF3NO |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(2-chloroethyl)-2,2,2-trifluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine |
| SMILES | FC(F)(F)CN(CCCl)CC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C13H21ClF3NO/c14-7-8-18(10-13(15,16)17)9-11-3-6-12(19-11)4-1-2-5-12/h11H,1-10H2 |
| InChIKey | MADIBWDRTRRJQD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|