C13H22BrF2NO — CID 107487448
N-(2-bromoethyl)-2,2-difluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine (PubChem CID 107487448) has the molecular formula C13H22BrF2NO and a molecular weight of 326.23 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-difluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine.
| Compound Name | N-(2-bromoethyl)-2,2-difluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107487448 |
| Molecular Formula | C13H22BrF2NO |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-(2-bromoethyl)-2,2-difluoro-N-(1-oxaspiro[4.4]nonan-2-ylmethyl)ethanamine |
| SMILES | FC(F)CN(CCBr)CC1CCC2(CCCC2)O1 |
| InChI | InChI=1S/C13H22BrF2NO/c14-7-8-17(10-12(15)16)9-11-3-6-13(18-11)4-1-2-5-13/h11-12H,1-10H2 |
| InChIKey | JFDJGPCWLGJXEW-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|