C11H20BrF2NO — CID 107487438
N-(2-bromoethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine (PubChem CID 107487438) has the molecular formula C11H20BrF2NO and a molecular weight of 300.19 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine.
| Compound Name | N-(2-bromoethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 107487438 |
| Molecular Formula | C11H20BrF2NO |
| Molecular Weight | 300.19 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | N-(2-bromoethyl)-N-[(5,5-dimethyloxolan-2-yl)methyl]-2,2-difluoroethanamine |
| SMILES | CC1(C)CCC(CN(CCBr)CC(F)F)O1 |
| InChI | InChI=1S/C11H20BrF2NO/c1-11(2)4-3-9(16-11)7-15(6-5-12)8-10(13)14/h9-10H,3-8H2,1-2H3 |
| InChIKey | UCGJHGISGIRILQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|