C10H18ClF2NO — CID 107488113
N-(2-chloroethyl)-2,2-difluoro-N-[(5-methyloxolan-2-yl)methyl]ethanamine (PubChem CID 107488113) has the molecular formula C10H18ClF2NO and a molecular weight of 241.71 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2-difluoro-N-[(5-methyloxolan-2-yl)methyl]ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2-difluoro-N-[(5-methyloxolan-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 107488113 |
| Molecular Formula | C10H18ClF2NO |
| Molecular Weight | 241.71 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | N-(2-chloroethyl)-2,2-difluoro-N-[(5-methyloxolan-2-yl)methyl]ethanamine |
| SMILES | CC1CCC(CN(CCCl)CC(F)F)O1 |
| InChI | InChI=1S/C10H18ClF2NO/c1-8-2-3-9(15-8)6-14(5-4-11)7-10(12)13/h8-10H,2-7H2,1H3 |
| InChIKey | VISRMUHJBRVOLI-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.71 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|