C9H18F2INO — CID 10591831
[(2R,5R)-4,4-difluoro-5-methyloxolan-2-yl]methyl-trimethylazanium iodide (PubChem CID 10591831) has the molecular formula C9H18F2INO and a molecular weight of 321.15 g/mol. Its IUPAC name is [(2R,5R)-4,4-difluoro-5-methyloxolan-2-yl]methyl-trimethylazanium iodide.
| Compound Name | [(2R,5R)-4,4-difluoro-5-methyloxolan-2-yl]methyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 10591831 |
| Molecular Formula | C9H18F2INO |
| Molecular Weight | 321.15 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | [(2R,5R)-4,4-difluoro-5-methyloxolan-2-yl]methyl-trimethylazanium iodide |
| SMILES | C[C@H]1O[C@@H](C[N+](C)(C)C)CC1(F)F.[I-] |
| InChI | InChI=1S/C9H18F2NO.HI/c1-7-9(10,11)5-8(13-7)6-12(2,3)4;/h7-8H,5-6H2,1-4H3;1H/q+1;/p-1/t7-,8-;/m1./s1 |
| InChIKey | XWPSKLSVXYNGGO-SCLLHFNJSA-M |
| XLogP | -1.49 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.15 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|