C9H16ClF2NO — CID 107487790
N-(2-chloroethyl)-2,2-difluoro-N-(oxolan-2-ylmethyl)ethanamine (PubChem CID 107487790) has the molecular formula C9H16ClF2NO and a molecular weight of 227.68 g/mol. Its IUPAC name is N-(2-chloroethyl)-2,2-difluoro-N-(oxolan-2-ylmethyl)ethanamine.
| Compound Name | N-(2-chloroethyl)-2,2-difluoro-N-(oxolan-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 107487790 |
| Molecular Formula | C9H16ClF2NO |
| Molecular Weight | 227.68 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | N-(2-chloroethyl)-2,2-difluoro-N-(oxolan-2-ylmethyl)ethanamine |
| SMILES | FC(F)CN(CCCl)CC1CCCO1 |
| InChI | InChI=1S/C9H16ClF2NO/c10-3-4-13(7-9(11)12)6-8-2-1-5-14-8/h8-9H,1-7H2 |
| InChIKey | KNTXVCMOKGNEFD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.68 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|