About N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine
N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine (PubChem CID 102860547) has the molecular formula C11H17ClN2S
and a molecular weight of 244.79 g/mol. Its IUPAC name is N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine |
| PubChem CID | 102860547 |
| Molecular Formula | C11H17ClN2S |
| Molecular Weight | 244.79 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine |
| SMILES | ClCCCN(Cc1cncs1)C1CCC1 |
| InChI | InChI=1S/C11H17ClN2S/c12-5-2-6-14(10-3-1-4-10)8-11-7-13-9-15-11/h7,9-10H,1-6,8H2 |
| InChIKey | ZOAXMLBMQXOKMO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.79 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine?
The IUPAC name of N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine (CID 102860547) is N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine.
What is the SMILES notation for N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine?
The canonical SMILES for N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine is ClCCCN(Cc1cncs1)C1CCC1.
What is the InChIKey of N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine?
The InChIKey is ZOAXMLBMQXOKMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17ClN2S/c12-5-2-6-14(10-3-1-4-10)8-11-7-13-9-15-11/h7,9-10H,1-6,8H2.
What are the key properties of N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine?
N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine has a molecular weight of 244.79 g/mol, XLogP of 3.13, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-N-(1,3-thiazol-5-ylmethyl)cyclobutanamine is sourced from PubChem (CID 102860547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).