C14H17N3S — CID 112640948
2-[[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]methyl]aniline (PubChem CID 112640948) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 2-[[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]methyl]aniline.
| Compound Name | 2-[[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 112640948 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 2-[[cyclopropyl(1,3-thiazol-5-ylmethyl)amino]methyl]aniline |
| SMILES | Nc1ccccc1CN(Cc1cncs1)C1CC1 |
| InChI | InChI=1S/C14H17N3S/c15-14-4-2-1-3-11(14)8-17(12-5-6-12)9-13-7-16-10-18-13/h1-4,7,10,12H,5-6,8-9,15H2 |
| InChIKey | DYGZVVCILLQLSD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|