C12H15F3N2 — CID 43460960
2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 43460960) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 43460960 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | 2-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | Nc1ccccc1CN(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C12H15F3N2/c13-12(14,15)8-17(10-5-6-10)7-9-3-1-2-4-11(9)16/h1-4,10H,5-8,16H2 |
| InChIKey | VVDLVRLNDFGVDI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|