C13H17F3N2 — CID 55009014
4-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline (PubChem CID 55009014) has the molecular formula C13H17F3N2 and a molecular weight of 258.29 g/mol. Its IUPAC name is 4-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline.
| Compound Name | 4-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 55009014 |
| Molecular Formula | C13H17F3N2 |
| Molecular Weight | 258.29 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | 4-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline |
| SMILES | Cc1cc(CN(CC(F)(F)F)C2CC2)ccc1N |
| InChI | InChI=1S/C13H17F3N2/c1-9-6-10(2-5-12(9)17)7-18(11-3-4-11)8-13(14,15)16/h2,5-6,11H,3-4,7-8,17H2,1H3 |
| InChIKey | HGSKQAMGCGZRNU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.29 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|