C13H14F4N2S — CID 107879322
5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-fluorobenzenecarbothioamide (PubChem CID 107879322) has the molecular formula C13H14F4N2S and a molecular weight of 306.33 g/mol. Its IUPAC name is 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-fluorobenzenecarbothioamide.
| Compound Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 107879322 |
| Molecular Formula | C13H14F4N2S |
| Molecular Weight | 306.33 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 5-[[cyclopropyl(2,2,2-trifluoroethyl)amino]methyl]-2-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(CN(CC(F)(F)F)C2CC2)ccc1F |
| InChI | InChI=1S/C13H14F4N2S/c14-11-4-1-8(5-10(11)12(18)20)6-19(9-2-3-9)7-13(15,16)17/h1,4-5,9H,2-3,6-7H2,(H2,18,20) |
| InChIKey | NIDKMQDMGILGBL-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.33 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|