C13H16BrFN2S — CID 54997392
3-[(3-bromo-4-fluorophenyl)methyl-cyclopropylamino]propanethioamide (PubChem CID 54997392) has the molecular formula C13H16BrFN2S and a molecular weight of 331.25 g/mol. Its IUPAC name is 3-[(3-bromo-4-fluorophenyl)methyl-cyclopropylamino]propanethioamide.
| Compound Name | 3-[(3-bromo-4-fluorophenyl)methyl-cyclopropylamino]propanethioamide |
|---|---|
| PubChem CID | 54997392 |
| Molecular Formula | C13H16BrFN2S |
| Molecular Weight | 331.25 g/mol |
| Exact Mass | 330.02 |
| IUPAC Name | 3-[(3-bromo-4-fluorophenyl)methyl-cyclopropylamino]propanethioamide |
| SMILES | NC(=S)CCN(Cc1ccc(F)c(Br)c1)C1CC1 |
| InChI | InChI=1S/C13H16BrFN2S/c14-11-7-9(1-4-12(11)15)8-17(10-2-3-10)6-5-13(16)18/h1,4,7,10H,2-3,5-6,8H2,(H2,16,18) |
| InChIKey | IJWOTQFGCKVIIF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|