C15H22BrFN2O — CID 111105354
2-[(3-bromo-4-fluorophenyl)methyl-(1-methylpiperidin-4-yl)amino]ethanol (PubChem CID 111105354) has the molecular formula C15H22BrFN2O and a molecular weight of 345.26 g/mol. Its IUPAC name is 2-[(3-bromo-4-fluorophenyl)methyl-(1-methylpiperidin-4-yl)amino]ethanol.
| Compound Name | 2-[(3-bromo-4-fluorophenyl)methyl-(1-methylpiperidin-4-yl)amino]ethanol |
|---|---|
| PubChem CID | 111105354 |
| Molecular Formula | C15H22BrFN2O |
| Molecular Weight | 345.26 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 2-[(3-bromo-4-fluorophenyl)methyl-(1-methylpiperidin-4-yl)amino]ethanol |
| SMILES | CN1CCC(N(CCO)Cc2ccc(F)c(Br)c2)CC1 |
| InChI | InChI=1S/C15H22BrFN2O/c1-18-6-4-13(5-7-18)19(8-9-20)11-12-2-3-15(17)14(16)10-12/h2-3,10,13,20H,4-9,11H2,1H3 |
| InChIKey | ZTBIQWBHGUAUSE-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |