C13H19F3N2 — CID 55009209
2-methyl-4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 55009209) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-methyl-4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2-methyl-4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 55009209 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-methyl-4-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | CCCN(Cc1ccc(N)c(C)c1)CC(F)(F)F |
| InChI | InChI=1S/C13H19F3N2/c1-3-6-18(9-13(14,15)16)8-11-4-5-12(17)10(2)7-11/h4-5,7H,3,6,8-9,17H2,1-2H3 |
| InChIKey | PANNXCXXNDUIAE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|