C12H16ClF3N2 — CID 55006318
2-chloro-5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline (PubChem CID 55006318) has the molecular formula C12H16ClF3N2 and a molecular weight of 280.72 g/mol. Its IUPAC name is 2-chloro-5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline.
| Compound Name | 2-chloro-5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
|---|---|
| PubChem CID | 55006318 |
| Molecular Formula | C12H16ClF3N2 |
| Molecular Weight | 280.72 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 2-chloro-5-[[propyl(2,2,2-trifluoroethyl)amino]methyl]aniline |
| SMILES | CCCN(Cc1ccc(Cl)c(N)c1)CC(F)(F)F |
| InChI | InChI=1S/C12H16ClF3N2/c1-2-5-18(8-12(14,15)16)7-9-3-4-10(13)11(17)6-9/h3-4,6H,2,5,7-8,17H2,1H3 |
| InChIKey | DOBGXTMYMSOLSW-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.72 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|