C12H17F3N2 — CID 55008961
4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline (PubChem CID 55008961) has the molecular formula C12H17F3N2 and a molecular weight of 246.28 g/mol. Its IUPAC name is 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline.
| Compound Name | 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline |
|---|---|
| PubChem CID | 55008961 |
| Molecular Formula | C12H17F3N2 |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 4-[[ethyl(2,2,2-trifluoroethyl)amino]methyl]-2-methylaniline |
| SMILES | CCN(Cc1ccc(N)c(C)c1)CC(F)(F)F |
| InChI | InChI=1S/C12H17F3N2/c1-3-17(8-12(13,14)15)7-10-4-5-11(16)9(2)6-10/h4-6H,3,7-8,16H2,1-2H3 |
| InChIKey | SYMYSRFSCPJLJW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|