C12H17NO5S2 — CID 102860892
3-[cyclobutyl(3-hydroxypropyl)sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 102860892) has the molecular formula C12H17NO5S2 and a molecular weight of 319.40 g/mol. Its IUPAC name is 3-[cyclobutyl(3-hydroxypropyl)sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[cyclobutyl(3-hydroxypropyl)sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 102860892 |
| Molecular Formula | C12H17NO5S2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 3-[cyclobutyl(3-hydroxypropyl)sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1S(=O)(=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C12H17NO5S2/c14-7-2-6-13(9-3-1-4-9)20(17,18)10-5-8-19-11(10)12(15)16/h5,8-9,14H,1-4,6-7H2,(H,15,16) |
| InChIKey | VDKINLZWJNCAFK-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |