C10H21BrN2 — CID 102861077
N'-(2-bromoethyl)-N'-cyclobutyl-N,N-dimethylethane-1,2-diamine (PubChem CID 102861077) has the molecular formula C10H21BrN2 and a molecular weight of 249.20 g/mol. Its IUPAC name is N'-(2-bromoethyl)-N'-cyclobutyl-N,N-dimethylethane-1,2-diamine.
| Compound Name | N'-(2-bromoethyl)-N'-cyclobutyl-N,N-dimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 102861077 |
| Molecular Formula | C10H21BrN2 |
| Molecular Weight | 249.20 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | N'-(2-bromoethyl)-N'-cyclobutyl-N,N-dimethylethane-1,2-diamine |
| SMILES | CN(C)CCN(CCBr)C1CCC1 |
| InChI | InChI=1S/C10H21BrN2/c1-12(2)8-9-13(7-6-11)10-4-3-5-10/h10H,3-9H2,1-2H3 |
| InChIKey | AXOBKCHLRFBHHW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.20 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|