C14H28BrN — CID 80674486
N-(2-bromoethyl)-N-(3,3-dimethylbutyl)cyclohexanamine (PubChem CID 80674486) has the molecular formula C14H28BrN and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(3,3-dimethylbutyl)cyclohexanamine.
| Compound Name | N-(2-bromoethyl)-N-(3,3-dimethylbutyl)cyclohexanamine |
|---|---|
| PubChem CID | 80674486 |
| Molecular Formula | C14H28BrN |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | N-(2-bromoethyl)-N-(3,3-dimethylbutyl)cyclohexanamine |
| SMILES | CC(C)(C)CCN(CCBr)C1CCCCC1 |
| InChI | InChI=1S/C14H28BrN/c1-14(2,3)9-11-16(12-10-15)13-7-5-4-6-8-13/h13H,4-12H2,1-3H3 |
| InChIKey | DDGQVOQXXJMIMK-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|