C14H27N3O2 — CID 102862098
N-cyclobutyl-N-(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 102862098) has the molecular formula C14H27N3O2 and a molecular weight of 269.39 g/mol. Its IUPAC name is N-cyclobutyl-N-(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | N-cyclobutyl-N-(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 102862098 |
| Molecular Formula | C14H27N3O2 |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | N-cyclobutyl-N-(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | CC(C)(C(=O)N(CCO)C1CCC1)N1CCNCC1 |
| InChI | InChI=1S/C14H27N3O2/c1-14(2,16-8-6-15-7-9-16)13(19)17(10-11-18)12-4-3-5-12/h12,15,18H,3-11H2,1-2H3 |
| InChIKey | ODUNFJSTWGGNPS-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |