C12H25N3O3 — CID 80548772
N,N-bis(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide (PubChem CID 80548772) has the molecular formula C12H25N3O3 and a molecular weight of 259.35 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide |
|---|---|
| PubChem CID | 80548772 |
| Molecular Formula | C12H25N3O3 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-methyl-2-piperazin-1-ylpropanamide |
| SMILES | CC(C)(C(=O)N(CCO)CCO)N1CCNCC1 |
| InChI | InChI=1S/C12H25N3O3/c1-12(2,15-5-3-13-4-6-15)11(18)14(7-9-16)8-10-17/h13,16-17H,3-10H2,1-2H3 |
| InChIKey | KWMYGYIKLULYLZ-UHFFFAOYSA-N |
| XLogP | -1.52 |
| TPSA | 76.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |