C14H20ClFN2 — CID 102862804
1-[(3-chloro-2-fluorophenyl)methyl]-3,7-dimethyl-1,4-diazepane (PubChem CID 102862804) has the molecular formula C14H20ClFN2 and a molecular weight of 270.78 g/mol. Its IUPAC name is 1-[(3-chloro-2-fluorophenyl)methyl]-3,7-dimethyl-1,4-diazepane.
| Compound Name | 1-[(3-chloro-2-fluorophenyl)methyl]-3,7-dimethyl-1,4-diazepane |
|---|---|
| PubChem CID | 102862804 |
| Molecular Formula | C14H20ClFN2 |
| Molecular Weight | 270.78 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | 1-[(3-chloro-2-fluorophenyl)methyl]-3,7-dimethyl-1,4-diazepane |
| SMILES | CC1CN(Cc2cccc(Cl)c2F)C(C)CCN1 |
| InChI | InChI=1S/C14H20ClFN2/c1-10-8-18(11(2)6-7-17-10)9-12-4-3-5-13(15)14(12)16/h3-5,10-11,17H,6-9H2,1-2H3 |
| InChIKey | XLMGLBFHNXJLNV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.78 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |