C12H18N4O — CID 102863037
6-[cyclobutyl(2-hydroxyethyl)amino]pyridine-2-carboximidamide (PubChem CID 102863037) has the molecular formula C12H18N4O and a molecular weight of 234.30 g/mol. Its IUPAC name is 6-[cyclobutyl(2-hydroxyethyl)amino]pyridine-2-carboximidamide.
| Compound Name | 6-[cyclobutyl(2-hydroxyethyl)amino]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 102863037 |
| Molecular Formula | C12H18N4O |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 6-[cyclobutyl(2-hydroxyethyl)amino]pyridine-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(CCO)C2CCC2)n1 |
| InChI | InChI=1S/C12H18N4O/c13-12(14)10-5-2-6-11(15-10)16(7-8-17)9-3-1-4-9/h2,5-6,9,17H,1,3-4,7-8H2,(H3,13,14) |
| InChIKey | YTKSIWCSDICIFX-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|