C18H13N3O2 — CID 10286338
2-(3-methoxy-4-pyridin-2-ylphenyl)-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 10286338) has the molecular formula C18H13N3O2 and a molecular weight of 303.32 g/mol. Its IUPAC name is 2-(3-methoxy-4-pyridin-2-ylphenyl)-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | 2-(3-methoxy-4-pyridin-2-ylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 10286338 |
| Molecular Formula | C18H13N3O2 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 2-(3-methoxy-4-pyridin-2-ylphenyl)-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | COc1cc(-c2nc3ncccc3o2)ccc1-c1ccccn1 |
| InChI | InChI=1S/C18H13N3O2/c1-22-16-11-12(7-8-13(16)14-5-2-3-9-19-14)18-21-17-15(23-18)6-4-10-20-17/h2-11H,1H3 |
| InChIKey | OMFGERNEFPPVJL-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |