C16H28N4O — CID 102864733
3-[[5-[(tert-butylamino)methyl]pyrimidin-2-yl]-cyclobutylamino]propan-1-ol (PubChem CID 102864733) has the molecular formula C16H28N4O and a molecular weight of 292.43 g/mol. Its IUPAC name is 3-[[5-[(tert-butylamino)methyl]pyrimidin-2-yl]-cyclobutylamino]propan-1-ol.
| Compound Name | 3-[[5-[(tert-butylamino)methyl]pyrimidin-2-yl]-cyclobutylamino]propan-1-ol |
|---|---|
| PubChem CID | 102864733 |
| Molecular Formula | C16H28N4O |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | 3-[[5-[(tert-butylamino)methyl]pyrimidin-2-yl]-cyclobutylamino]propan-1-ol |
| SMILES | CC(C)(C)NCc1cnc(N(CCCO)C2CCC2)nc1 |
| InChI | InChI=1S/C16H28N4O/c1-16(2,3)19-12-13-10-17-15(18-11-13)20(8-5-9-21)14-6-4-7-14/h10-11,14,19,21H,4-9,12H2,1-3H3 |
| InChIKey | RZPJRMPRKQUCSC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |