About 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine
7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine (PubChem CID 102864764) has the molecular formula C11H13ClFNS
and a molecular weight of 245.75 g/mol. Its IUPAC name is 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine.
Molecular Properties
| Compound Name | 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| PubChem CID | 102864764 |
| Molecular Formula | C11H13ClFNS |
| Molecular Weight | 245.75 g/mol |
| Exact Mass | 245.04 |
| IUPAC Name | 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine |
| SMILES | CNC1c2ccc(Cl)c(F)c2CSC1C |
| InChI | InChI=1S/C11H13ClFNS/c1-6-11(14-2)7-3-4-9(12)10(13)8(7)5-15-6/h3-4,6,11,14H,5H2,1-2H3 |
| InChIKey | NXAKZTTUQSJCKI-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.75 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The IUPAC name of 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine (CID 102864764) is 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine.
What is the SMILES notation for 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The canonical SMILES for 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine is CNC1c2ccc(Cl)c(F)c2CSC1C.
What is the InChIKey of 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
The InChIKey is NXAKZTTUQSJCKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClFNS/c1-6-11(14-2)7-3-4-9(12)10(13)8(7)5-15-6/h3-4,6,11,14H,5H2,1-2H3.
What are the key properties of 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine?
7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine has a molecular weight of 245.75 g/mol, XLogP of 3.37, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-8-fluoro-N,3-dimethyl-3,4-dihydro-1H-isothiochromen-4-amine is sourced from PubChem (CID 102864764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).