C14H20N2O4 — CID 102866003
1-[2-[cyclobutyl(3-hydroxypropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid (PubChem CID 102866003) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is 1-[2-[cyclobutyl(3-hydroxypropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid.
| Compound Name | 1-[2-[cyclobutyl(3-hydroxypropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 102866003 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | 1-[2-[cyclobutyl(3-hydroxypropyl)amino]-2-oxoethyl]pyrrole-2-carboxylic acid |
| SMILES | O=C(O)c1cccn1CC(=O)N(CCCO)C1CCC1 |
| InChI | InChI=1S/C14H20N2O4/c17-9-3-8-16(11-4-1-5-11)13(18)10-15-7-2-6-12(15)14(19)20/h2,6-7,11,17H,1,3-5,8-10H2,(H,19,20) |
| InChIKey | VUYZIFCASYIDGH-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 82.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |