C6H11F2N — CID 102867628
1,1-difluoro-N-prop-2-enylpropan-2-amine (PubChem CID 102867628) has the molecular formula C6H11F2N and a molecular weight of 135.16 g/mol. Its IUPAC name is 1,1-difluoro-N-prop-2-enylpropan-2-amine.
| Compound Name | 1,1-difluoro-N-prop-2-enylpropan-2-amine |
|---|---|
| PubChem CID | 102867628 |
| Molecular Formula | C6H11F2N |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.09 |
| IUPAC Name | 1,1-difluoro-N-prop-2-enylpropan-2-amine |
| SMILES | C=CCNC(C)C(F)F |
| InChI | InChI=1S/C6H11F2N/c1-3-4-9-5(2)6(7)8/h3,5-6,9H,1,4H2,2H3 |
| InChIKey | QZFFHECBZIWDHK-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.16 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|