C9H17F2NO — CID 102867805
4-(1,1-difluoropropan-2-ylamino)cyclohexan-1-ol (PubChem CID 102867805) has the molecular formula C9H17F2NO and a molecular weight of 193.24 g/mol. Its IUPAC name is 4-(1,1-difluoropropan-2-ylamino)cyclohexan-1-ol.
| Compound Name | 4-(1,1-difluoropropan-2-ylamino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 102867805 |
| Molecular Formula | C9H17F2NO |
| Molecular Weight | 193.24 g/mol |
| Exact Mass | 193.13 |
| IUPAC Name | 4-(1,1-difluoropropan-2-ylamino)cyclohexan-1-ol |
| SMILES | CC(NC1CCC(O)CC1)C(F)F |
| InChI | InChI=1S/C9H17F2NO/c1-6(9(10)11)12-7-2-4-8(13)5-3-7/h6-9,12-13H,2-5H2,1H3 |
| InChIKey | MVEKANSIYLKLCN-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |