C18H24N2O3S — CID 10286805
N-[(2R)-2-hydroxy-4-pyrrolidin-1-ylbutyl]naphthalene-1-sulfonamide (PubChem CID 10286805) has the molecular formula C18H24N2O3S and a molecular weight of 348.47 g/mol. Its IUPAC name is N-[(2R)-2-hydroxy-4-pyrrolidin-1-ylbutyl]naphthalene-1-sulfonamide.
| Compound Name | N-[(2R)-2-hydroxy-4-pyrrolidin-1-ylbutyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10286805 |
| Molecular Formula | C18H24N2O3S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | N-[(2R)-2-hydroxy-4-pyrrolidin-1-ylbutyl]naphthalene-1-sulfonamide |
| SMILES | O=S(=O)(NC[C@H](O)CCN1CCCC1)c1cccc2ccccc12 |
| InChI | InChI=1S/C18H24N2O3S/c21-16(10-13-20-11-3-4-12-20)14-19-24(22,23)18-9-5-7-15-6-1-2-8-17(15)18/h1-2,5-9,16,19,21H,3-4,10-14H2/t16-/m1/s1 |
| InChIKey | LIWJJHYLJPTBAV-MRXNPFEDSA-N |
| XLogP | 1.96 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |