C28H37Cl2N3O3S — CID 10166689
N-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)phenyl]naphthalene-1-sulfonamide;dihydrochloride (PubChem CID 10166689) has the molecular formula C28H37Cl2N3O3S and a molecular weight of 566.60 g/mol. Its IUPAC name is N-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)phenyl]naphthalene-1-sulfonamide;dihydrochloride.
| Compound Name | N-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)phenyl]naphthalene-1-sulfonamide;dihydrochloride |
|---|---|
| PubChem CID | 10166689 |
| Molecular Formula | C28H37Cl2N3O3S |
| Molecular Weight | 566.60 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | N-[4-hydroxy-3,5-bis(piperidin-1-ylmethyl)phenyl]naphthalene-1-sulfonamide;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(Nc1cc(CN2CCCCC2)c(O)c(CN2CCCCC2)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C28H35N3O3S.2ClH/c32-28-23(20-30-14-5-1-6-15-30)18-25(19-24(28)21-31-16-7-2-8-17-31)29-35(33,34)27-13-9-11-22-10-3-4-12-26(22)27;;/h3-4,9-13,18-19,29,32H,1-2,5-8,14-17,20-21H2;2*1H |
| InChIKey | YJXLKPLLSXTRPT-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.60 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|