C10H13F2NS — CID 102868390
N-(1,1-difluoropropan-2-yl)-2-methylsulfanylaniline (PubChem CID 102868390) has the molecular formula C10H13F2NS and a molecular weight of 217.28 g/mol. Its IUPAC name is N-(1,1-difluoropropan-2-yl)-2-methylsulfanylaniline.
| Compound Name | N-(1,1-difluoropropan-2-yl)-2-methylsulfanylaniline |
|---|---|
| PubChem CID | 102868390 |
| Molecular Formula | C10H13F2NS |
| Molecular Weight | 217.28 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | N-(1,1-difluoropropan-2-yl)-2-methylsulfanylaniline |
| SMILES | CSc1ccccc1NC(C)C(F)F |
| InChI | InChI=1S/C10H13F2NS/c1-7(10(11)12)13-8-5-3-4-6-9(8)14-2/h3-7,10,13H,1-2H3 |
| InChIKey | GUAXHYBFBYZZPG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |