C14H12Cl3FN2 — CID 102868631
[2-(3-chloro-2-fluorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine (PubChem CID 102868631) has the molecular formula C14H12Cl3FN2 and a molecular weight of 333.62 g/mol. Its IUPAC name is [2-(3-chloro-2-fluorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [2-(3-chloro-2-fluorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 102868631 |
| Molecular Formula | C14H12Cl3FN2 |
| Molecular Weight | 333.62 g/mol |
| Exact Mass | 332.01 |
| IUPAC Name | [2-(3-chloro-2-fluorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cccc(Cl)c1F)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H12Cl3FN2/c15-10-4-9(5-11(16)7-10)13(20-19)6-8-2-1-3-12(17)14(8)18/h1-5,7,13,20H,6,19H2 |
| InChIKey | JRTCOEQFDJXCKQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.62 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|