C14H12Cl4N2 — CID 105309863
[2-(2,5-dichlorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine (PubChem CID 105309863) has the molecular formula C14H12Cl4N2 and a molecular weight of 350.08 g/mol. Its IUPAC name is [2-(2,5-dichlorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [2-(2,5-dichlorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105309863 |
| Molecular Formula | C14H12Cl4N2 |
| Molecular Weight | 350.08 g/mol |
| Exact Mass | 347.98 |
| IUPAC Name | [2-(2,5-dichlorophenyl)-1-(3,5-dichlorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(Cl)ccc1Cl)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H12Cl4N2/c15-10-1-2-13(18)8(3-10)6-14(20-19)9-4-11(16)7-12(17)5-9/h1-5,7,14,20H,6,19H2 |
| InChIKey | LRTWDUDKVTZTCE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.08 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|