C14H13BrCl2N2 — CID 105192530
[1-(4-bromophenyl)-2-(2,5-dichlorophenyl)ethyl]hydrazine (PubChem CID 105192530) has the molecular formula C14H13BrCl2N2 and a molecular weight of 360.08 g/mol. Its IUPAC name is [1-(4-bromophenyl)-2-(2,5-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [1-(4-bromophenyl)-2-(2,5-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 105192530 |
| Molecular Formula | C14H13BrCl2N2 |
| Molecular Weight | 360.08 g/mol |
| Exact Mass | 357.96 |
| IUPAC Name | [1-(4-bromophenyl)-2-(2,5-dichlorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1cc(Cl)ccc1Cl)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H13BrCl2N2/c15-11-3-1-9(2-4-11)14(19-18)8-10-7-12(16)5-6-13(10)17/h1-7,14,19H,8,18H2 |
| InChIKey | ABRWLZRDGXCREQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.08 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|