C14H12Br2Cl2N2 — CID 107978987
[1-(3,5-dibromophenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine (PubChem CID 107978987) has the molecular formula C14H12Br2Cl2N2 and a molecular weight of 438.98 g/mol. Its IUPAC name is [1-(3,5-dibromophenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine.
| Compound Name | [1-(3,5-dibromophenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine |
|---|---|
| PubChem CID | 107978987 |
| Molecular Formula | C14H12Br2Cl2N2 |
| Molecular Weight | 438.98 g/mol |
| Exact Mass | 435.87 |
| IUPAC Name | [1-(3,5-dibromophenyl)-2-(2,4-dichlorophenyl)ethyl]hydrazine |
| SMILES | NNC(Cc1ccc(Cl)cc1Cl)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H12Br2Cl2N2/c15-10-3-9(4-11(16)6-10)14(20-19)5-8-1-2-12(17)7-13(8)18/h1-4,6-7,14,20H,5,19H2 |
| InChIKey | BXWXOZDOEIFTKC-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.98 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|